Processing math: 100%

Equilibrium - Class 11 Engineering Chemistry - Extra Questions

An endothermic reaction which proceeds with decrease in volume will give maximum yield of the products at high P and high T .
If true enter 1, if false  enter 0.



An exothermic reaction which proceeds with decrease in volume will give maximum yield at high P and low T
If true enter 1, if false  enter 0.



The solubility of a solute decrease with temperature when dissolution is exothermic.
If true enter 1, if false enter 0. 



Addition of an inert gas at constant volume to the equilibrium mixture does not influence the equilibrium.
If true enter 1, if false enter 0.



For a reversible system at constant temperature, the value of Kc increases if the concentrations are changed at equilibrium.
If true enter 1, if false enter 0.



The degree of dissociation of PCl5 of decreases with increase in pressure.
If true enter 1, if false enter 0.



When a liquid and its vapours are at equilibrium and the pressure is suddenly decreased, cooling occurs.
If true enter 1, if false enter 0.



Solubility of NaOH increases with increase in temperature.
If true enter 1, if false enter 0.



The equilibrium constant does not depend on the initial concentration of reactants but depends on concentration of various species at equilibrium .
If true enter 1, if false  enter 0.



Le Chatelier's principle finds extensive application in predicting the conditions for getting maximum yield of products in reactions of industrial importance.
If true enter 1, if false enter 0.



High pressure is favourable for those reversible reactions in which there is decrease in the number of molecules.
If true enter 1, if false  enter 0.



The equilibrium constants for the reaction, N2(g)+O2(g)2NO(g) at 1727oC and 2227oC are 4.08×104 and 3.6×103 respectively. Calculate the enthalpy change for the reaction. (Given R=1.987 cal mol1K1)



The value of equilibrium constant of a reaction depends upon the initial values of concentration of reactants.
If true enter 1, else enter 0.



The reaction : CaCO3(g)CaO(s)+CO2(g), would proceed to completion if the reaction vessel is connected to bottle containing KOH solution or carried out in open vessel.
If true enter 1, if false enter 0.



The dissociation of CaCO3 is suppressed at high pressure.
If true enter 1, if false enter 0.



In an equilibrium reaction, the concentration of reactants decreases initially and then becomes constant.
If true enter 1, if false enter 0.



In a reversible reaction, some amount of heat energy is liberated in the forward reaction. Name the reaction. What change in temperature favours the forward reactions?



What is the effect of pressure on the equilibrium of the nitrogen and oxygen to give nitric oxide?



State the Le Chatelier's principle?



State Le Chatelier's principle.



State Le-chatlier's principle.



Which measurable property becomes constant in water water vapour equilibrium at constant temperature?



Variation of equilibrium constant K with temperature T is given by van't Hoff equation:
logK=logAΔHo2.303RT
A graph between logK and T1 was a straight line as shown in the figure and having θ=tan1(0.5) and OP=10. Calculate:
(a) ΔHo (Standard heat of reaction) when T=298K
(b) A (pre-exponential factor)
(c) Equilibrium constant K at 298K
(d) K at 798K, if ΔHo is independent of temperature
657997_2c70abb70e474ff9a5291a27f83787ea.png



Match the reaction equilibrium from List I with the factors which can affect it from List II.



Explain the effect of change in concentrations on the following equillibria:
a) PCl5(g)PCl3(g)Cl2(g)
b) 2SO2(g)+O2(g)2SO3(g)



The Kp for the reaction; H2+I22HI, at 460oC is 49. If the initial pressure of H2 and I2 is 0.5 atm respectively, determine the partial pressure of each gas at equilibrium.



Why does a gas fizz when a soda water bottle is opened?



(a) What would be the effect of an increase in pressure on following equilibria:
(i) CO(g)+2H2(g)CH3OH(g)
(ii) 2HBr(g)H2(g)+Br2(g)
(iii)CO2(g)+C(s)2CO(g)
(iv)COCI2(g)CO(g)+CI2(g)
(b)In above cases if temperature is increased then what should be the direction o f reaction



In a gaseous reaction, A(g)+B(g)C(g). Predict the effect of addition of inert gas if addition is made at (a) constant volume, (b) constant pressure.



How do the following help in bringing about a chemical change?
Pressure 



What is the effect of increasing pressure on the equilibrium?
N2+3H2 2NH3 ?



Name the factors that affect equilibrium position of a reversible reaction.



Under what conditions the synthesis of SO3 is more ? Explain. 



What will be the effect on equilibrium when Δ ng is negative and pressure is decreased? 



Which of the following reactions will get affected by increasing the pressure ? Also, mention whether change will cause the reaction to go into forward or backward direction.
(i) COCl2(g)CO(g)+Cl2(g) 
(ii) CH4(g)+2H2S(g)CS2(g)+4H2(g) 
(iii) CO2(g)+C(s)2CO(g) 
(iv) 2H2(g)+CO(g)CH3OH(g) 
(v) CaCO3(s)CaO(s)+CO2(g) 
(vi) 4NH3(g)+SO2(g)4NO(g)+6H2O(g)



For the system, N2+O22NO, -44 kcal, at equilibrium, what will be the effect of the following: 
(i) Increasing the temperature
(ii) Decreasing the pressure
(iii) Increasing the concentration of NO 
(iv) Presence of catalyst



Describe the factors which affect chemical equilibrium? 



Write the examples of the reaction in which
(a) product increases on increasing the pressure. 
(b) product increases on increasing the temperature. 



The equilibrium for the synthesis of ammonia is
N2+3H2NH3+xkJ,
What is the effect of pressure, temperature and concentration on this equilibrium? 



What will be the effect of temperature and pressure on the following equilibrium?
N2(g)+3H2(g)2NH3(g)



What is the effect of reducing the volume on the system described below?



H2(g)+I2(g)2HI(g)+ Heat
The following circumstances influence the reaction
Increase the temperature.



H2(g)+I2(g)2HI(g)+ Heat
The following circumstances influence the reaction
Increase the pressure



At normal temperature and pressure, 5.29mL hydrogen reacts with 0.040 gm iodine at 4440C and gives 6.35 mL hydrogen iodide. Calculate equilibrium constant for the synthesis of HI at this temperature. 



A process is given below. What happens to the process if it subjected to a change given in the brackets?
N2(g)+O2(g)2NO(g)180.7 kJ ( Pressure is increased and temperature is decreased).



The following reaction has attained equilibrium
CO(g)+2H2(g)CH3OH(g),ΔHo=92.0 kJ mol1
What will happen if Volume of the reaction vessel is suddenly reduced to half?



H2(g)+I2(g)2HI(g)+ Heat
The following circumstances influence the reaction
Increase the concentration of H2.



The following reaction has attained equilibrium
CO(g)+2H2(g)CH3OH(g),ΔHo=92.0 kJ mol1
What will happen if the partial pressure of hydrogen is suddenly doubled?



Hydrogen gas is obtained from natural gas by partial oxidation with steam according to the following endothermic reaction 
CH4(g)+H2O(g)CO(g)+3H2(g)
How will the value of Kp and composition of the equilibrium mixture be affected by increasing the pressure?



Hydrogen gas is obtained from natural gas by partial oxidation with steam according to the following endothermic reaction 
CH4(g)+H2O(g)CO(g)+3H2(g)
How will the value of Kp and composition of the equilibrium mixture be affected by increasing the temperature?



The following system is in equilibrium 
SO2Cl2+HeatSO2Cl2, What will happen to the temperature of the system if some Cl2 is added into at constant volume? Give reason.



List I and List II contain four entries each. Entries of List I are to be matched with entries of List II. One or more than one entries of List I may match with the same entry of List II.



List I and List II contains four entries each. Entries of List I are to be matched some entries of List II. One or more than one entries of List I may have the match with the same entry of List II.



Column I and Column II contains four entries each.Entries of Column I are to be matched some entries of Column II.One or more than one entries of Column I may have the matching with the same entries of Column II.



List I and List II contains four entries each. Entries of List I are to be matched some entries of List II. One or more than one entries of List I may have the match with the same entry of List II.



List I and List II contains four entries each. Entries of List I are to be matched some entries of List II. One or more than one entries of List I may have the match with the same entry of List II.



Statement: The equilibrium mole obtained during the experiment for the given reaction in 1 L vessel is shown below the reactants and products.
                               2A(g)+B(g)3C(g)+3D
At equilibrium:      8 mol    16 mol        4 mol     4 mol

If the reaction in the forward direction is to be made, the initial concentration of reactants and products should be such that the reaction quotient should be less than four.

If the given statement is true enter 1 if false enter 0.



A liquid is in equilibrium with its vapour in a sealed container at a fixed temperature. The volume of the container is suddenly increased.
How do rates of evaporation and condensation change initially?



A liquid is in equilibrium with its vapour in a sealed container at a fixed temperature. The volume of the container is suddenly increased.
What is the initial effect of the change on vapour pressure?



A liquid is in equilibrium with its vapour in a sealed container at a fixed temperature. The volume of the container is suddenly increased.
What happens when equilibrium is restored finally and what will be the final vapour pressure?



Match the column. The codes for the lists have choices (A),(B),(C)and(D) out of which only ONE is correct.



At 473 K, equilibrium constant Kc for decomposition of phosphorus pentachloride, PCl5 is 8.3×103. If decomposition is depicted as,
PCl5(g)PCl3(g)+Cl2(g) ΔrH=124.0kJmol1
(a) Write an expression for Kc for the reaction.
(b) What is the value of Kc for the reverse reaction at the same temperature?
(c) What would be the effect on Kc if (i) more PCl5 is added (ii) pressure is increased (iii) the temperature is increased ?



Dihydrogen gas is obtained from natural gas by partial oxidation with steam as per following endothermic reaction:

CH4(g)+H2O(g)CO(g)+3H2(g)

(a) Write as expression for Kp for the above reaction.

(b) How will the values of Kp and composition of equilibrium mixture be affected by
(i) increasing the pressure,
(ii) Increasing the temperature and
(iii) Using a catalyst?



Which of the following reactions will get affected by increasing the pressure? Also, mention whether change will cause the reaction to go into forward or backward direction.
(i) COCl2(g)CO(g)+Cl2(g)
(ii) CH4(g)+2S2(g)CS2(g)+2H2S(g)
(iii) CO2(g)+C(s)2CO(g)
(iv) 2H2(g)+CO(g)CH3OH(g)
(v) CaCO3(s)CaO(s)+CO2(g)
(vi) 4NH3(g)+5O2(g)4NO(g)+6H2O(g)



Does the number of moles of reaction products increase, decrease or remain same when each of the following equilibria is subjected to a decrease in pressure by increasing the volume?
(a) PCl5(g)PCl3(g)Cl2(g)
(b) CaO(s)+CO2(g)CaCO3(s)
(c) 3Fe(s)+4H2O(g)Fe3O4(s)+4H2(g)



State Le-chatelier's principle and apply it to the following equilibrium.
N2(g)+3H2(g)2NH3(g);H=92.0 KJ



State Le Chatelier's principle and apply it to the following equilibrium.
2SO2(g)+O2(g)2SO3(g);H=189k.J



When 3.06 g of NH4HS(s) is introduced into a two litre evacuated flask at 27oC, 30% of the solid decomposes into gaseous ammonia and hydrogen sulphide.
(i) Calculate Kc and Kp for the reaction at 27oC.
(ii) What would happen to the equilibrium when more NH4HS(s) is introduced into the flask?



For the reaction, SO2(g)+12O2(g)SO3(g), Kp is 32 atm1/2 at 800K and ΔH for the reaction is 187.9kJ mol1. Calculate its value at 900K, if it is assumed that ΔH remains constant over this range of temperature.



Write the effect of temperature pressure and concentration on the following reaction 2SO2+O22So3;ΔH=198 kJ/mol



In a gaseous reaction; A(g)+B(g)C(g)+D(g), the increase in temperature causes the change in the concentrations of A,B,C and D. The concentrations of C and D also change on addition of some amount of A. Does the value of K change in either of the two situations?



The reaction:

Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g)

It was studied by analysing the equilibrium mixture for the amount of H2S produced. A vessel whose volume was 2.5 litre was filled with 0.01 mole of Sb2S3 and 0.01 mole of H2S. After the mixture came to equilibrium in the closed vessel at 440oC, the gaseous mixture was removed and the H2S was dissolved in water. Sufficient Pb2+ ions were added to react completely with the H2S to precipitate PbS. If 1.029g of PbS was obtained, what is the value of Kc at 440oC?



A tenfold increase in pressure on the reaction, N2(g)+3H22NH3(g) at equilibrium results in .......... in Kp.



What is the equilibrium constant for this dissolving process?



Derive the best conditions for dissociation of NH3. Given 2NH3N2+3H2;H=+91.94 kJ.



The chemical equation of one of the different stages of manufacturing sulphuric acid by the contact process is given below. Find out the influence of the following factors in the reaction given below.
2SO2(g)+O2(g)2SO3(g)+heat

Increase the amount of oxygen. 



Following data is given for the reaction: CaCO3(s)CaO(s)+CO2(g)
ΔfH[CaO(s)]=635.1kJ mol1
ΔfH[CO2(g)]=393.5kJ mol1
ΔfH[CaCO3(s)]=1206.9kJ mol1
Predict the effect of temperature on the equilibrium constant of the above reaction.



The chemical equation of one of the different stages of manufacturing sulphuric acid by contact process is given below. Find out the influence of the following factors in the reaction given below.
2SO2(g)+O2(g)2SO3(g)+heat

Pressure is increased



For an exothermic reaction, what happens to the equilibrium constant if temperature is increased?



Class 11 Engineering Chemistry Extra Questions