Processing math: 100%

Hydrocarbons - Class 11 Engineering Chemistry - Extra Questions

What effect the branching of an alkane has on it melting point?



The direct iodination of alkane fail to product an alkyl iodid. If true enter 1, else 0.



2-butyne is less reactive than butene towards electrophilic addition reaction. If true press 1 else 0.



When 1pentene is treated with an acid, trans2pentene is produced. Propose mechanism of this isomerization reaction and justify.



How do you account for the formation of ethane during chlorination of methane?



For the following compounds, write structural formulas and IUPAC names for all possible isomers having the number of the double or triple bond as indicated : 
(a) C4H8(one double bond)     
(b)C5H8 (one triple bond)



Write IUPAC names of the following compound:
CH3CH=C(CH3)2



Let us consider the following reaction
CH2=CHCH=CH2+HBr80oCA(Major)+B(Minor).
At which carbon (follow IUPAC nomenclature) bromine is present in the major product?



Identify 'A' and 'B' in the following reactions? 
1151737_fe17f72fd46844dfadb9f0919a954dde.png



How is chloroform converted into Methane?



The reaction CH2=CH2+CH3COClAlCl3 gives the product:



Convert Propene into Propan1ol



Heat of Hydrogenation of C6H6 & Cyclohexene is K & Y. Find Resonance energy. 



Write the name and formula of the product formed in each case below:
H2C=CH2+HBr........



Bring out the following conversions:
Acetaldehyde to Ethane



Write the name and formula of the product formed in each case below:
C2H4+Cl2.................



Complete and balanced the following equations. State the conditions wherever necessary. 
C2H4+HCl............



Give reaction : What happens when :
Passing ethene in cold aqueous solution of alkaline potassium permanganate.



Complete and balanced the following equations. State the conditions wherever necessary. 
C2H2+Br2...........



Explain with chemical equation what happens when:
Acetylene reacts with bromine water ? 



Complete the reaction : 
1767880_1eb22f8a012b4134822f5591464e48b8.png




Identify the products in the following reactions:
1768548_01fd47200ad34fe08e937b1f0664bc9d.png



Complete the reaction:
1767878_798fb0f244fc42a7bae9cdeac3b9ef10.png




Identify the product when (A) reacts with:
Br2/CCl4
1768613_47c6c4e812264992af767d59713f523d.png



Among the isomers of pentane (C5H12), Write the one which on photochemical chlorination yields a singe monochloride.



Complete the following, giving the structures of the principal organic products:
1769232_fe4f120c7591490c99ef6106b68a8712.png



Write the name and formula of the product formed in each case below:
CH2=CH2alk. KMnO4...........



Ethanol can be converted into ethene which can be changed into ethane. choose the correct word or phrase from the brackets to complete the following sentences.
The conversion of ethene into ethane  is an example of _________



Consider the three types of replacement of group X by group Y as shown here.
This can result in giving compound (A) or (B) or both. What is the process called if 
(A) is the only compound obtained
1779576_fcf144937a81491894a2cd1a9e6f1906.png



Write the chemical equations for the following conversions ( not more than 2 steps):
Acetone to propene



Name the alkene which will yield 1-chloro-1-methylclohexane by the reaction with HCl. Write the reactions involved.



Consider the three types of replacement of group X by group Y as shown here.
This can result in giving compound (A) or (B) or both. what is the process called if
(A) and (B) are formed in equal proportions.
1779581_251265804c6845bca8e2a491e725de1b.png



Consider the tree types of replacement of group X by group Y as shown here.
This can result in giving compound (A) or (B) or both. what is the process called if 
(B) is the only compound obtained.
1779578_8deaadec94a74ee88da1b43925677b49.png



What do you observe when ethylene is passed through alkaline KMnO4 solution?



Chlorination of ethane to ethy1 chloride is more practicable than the chlorination of n-pentane to 1-chloropentane.



"n-pentane has lesser boiling point than neopentane"



Alkynes are more reactive than alkene towards catalytic hydrogenation. State whether the statement is True or False



"Mg2C3 on reaction with water forms propane."
Answer whether the above statement is true or false.
If true enter 1, else enter 0.



Free radical chlorination is a highly reactive process but very less selective, however, free radical bromination is less reactive, require a greater amount of energy very highly selective.
State whether the statement is True or False



Complete the following reaction :
HC CH Hg2+H2SO4(A)O(B).



Isopropyl chloride and ethyl chloride both react with Na in presence of dry ether. How many products are obtained?



BLiadlarRCCRNa/NH3A
What is A and B in the given raction repectivley?



Explain the free radical mechanism of chlorination of methane.



What is the number of stereo isomers possbile for the given compound?
988401_3b75275165c74d7a91662e087beb61c9.png



Product all the alkenes that would be formed by dehydrohalogenation of the following halides with sodium ethoxide in ethanol and identify the major alkene:
(i) 1-Bromo-1-methylcyclohexane
(ii) 2-Chloro-2-methylbutane
(iii) 2,2,3-Trimethyl-3-bromopentane.



Alkanes are called paraffin's. They undergo substitution reactions with chlorine in present of sunlight. Prove this with suitable example.



Identify B.
1087612_f5d3d966e3c54d2f9da48cb87d62c1c8.png



A and B are:
1103169_b8010b40e4fa465396f7de7020c5bdfd.png



C6H6HNO3H2SO4ABr2FeBr3B, Find the final product B.



How is propyne prepared from an :
(i) alkylene dihalide
(ii) alkylidene dihalide and
(iii) Tetrahaloalkane



What is the producy 'P'.
1133067_2c4acc86ea054598b27f174e88a66e7b.png




Complete the reaction.
1105203_ad46804fc1bf4c238a251e8eb299f105.png



1,1-Dihalides undergo dehydrohalogenation when treated with NaNH2 to give alkynes .
CH3CH2CHCl2CH3CCH



Nitrosyl chloride, NOCl, is a reactive gas that is sometimes formed when NO reacts with Cl2. NOCl is a strong electrophile and readily undergoes an addition reaction with alkenes. Complete the diagram to show the mechanism of the electrophilic addition reaction of NOCl with ethene.
Include all necessary charges, lone pairs and curly arrows, and the structure of the organic intermediate.

1642273_c46f53fd94774f918f7e231f240e6d2f.png



Complete the following table:

 Straight chain of Carbon compound Structural formulaMolecular formula  Name
 C HH|C|HH CH4Methane 
 CC -Ethane 
 CCC -C3H8 -
 CCCC HH|C|HH|C|HH|C|HH|C|HH



HCCHNaNH2 _______ CH3Br ________.



Fill in the blanks :
H2C=CH2Br2CCl4 ______ Alc.KOH ______.



Trialkylborane on deomposition by CH3COOH forms ______.



Complete the following equations :

C6H5CH=CHCH3Br2H2O(A).



Complete the following equations:
(CH3)2C=CH2+isobutaneHF273 K(A).



What happens when :
Acetylene is passed through ammonical cuprous chloride solution?



What type of reactions usually occur in alkenes?



What happens when :
Acetylene is passed through ammoniacal solution of silver nitrate?



 What happens when ethyl bromide is heated with zinc? Give equations only: 



Fill in the blanks:
Electrolysis of an aqueous solution of sodium propionate will form ____



How will you synthesise?
But2yne from propyne.



How will you synthesise 2,3Dimethylbutane from propene?



Provide the structures of compounds A, B, C, and D in the above questions.
1767857_af8147dfbce34140a590b8c67b7c3294.png



How will you bring about the following conversions in not more than two steps?
But1ene to but2ene



What are addition reactions? Which category of compounds undergoes addition reactions? Explain. 



What is the function of conc. H2SO4 in the formation of ethane from ethanol?



What are alkanes? Write general formula of alkanes and four general methods for preparation of alkanes. 



Explain with chemical equation what happens when: 
Hydrogen bromide is added to acetylene. 



The boiling point of re-pentane is higher than neopentane. Explain the reason. 



Why alkanes are chemically inert? Explain general reaction of alkanes.



Write the common name,IUPAC name and formula of isomers of butane, pentane and hexane.



Give reasons for the following:
The melting points alkanes with odd number of carbon atoms are lower than those with even number of carbon atoms



Pick out the suitable compounds from the box for the following reactions
CH4, C2H4, C3H8, CH3Cl

A) Addition Reaction



How can alkanes be prepared from alcohol



What effect does branching of an alkane have on its melting point?



Which of the following has the highest boiling point?
2 methylpentane
2,3 dimethylbutane
2,2 dimethylbutane.



Discuss briefly the mechanism of halogenation of methane.



Arrange the following in order of increasing volatility : gasoline, kerosene and diesel. 



Consider the electrophilic addition reaction of List 1 and match them with the properties of product from List 2



CH3CH2CH2CH2CH2CHCl2+NaNH2/NH3

How many sp hybridized carbon atoms are present in the product.



For C4H8 (one double bond), write the structural formula and IUPAC name for all possible isomers.



Explain the mechanism of the following reaction:
CH3CH2OHH+443KCH2=CH2+H2O




(i) CHCH(A)(B)(O)CH3COOH(C)CH2ClCOOH

Complete the given reactions:

768960_0a40eb17bc8041998bc19535b4718f7b.png



Give reasons for the following:
Straight chain alkanes posses higher boiling points than the corresponding branched chain isomers.



Alkenes like ethene dissolve in conc. H2SO4 but alkynes like ethyne do not dissolve in conc. H2SO4, whereas but-2-yne dissolves. Explain.



What is the product of the given reaction? 
880858_7618ca670ad14129901be41e16581b5f.png



Propene (CH3CH=CH2) can be transformed to compound (a to j) listed in the left-hand column.
Write letter designating the reagent, you believe will achieve desired transformation. In the case of a multi step sequence, write the reagent in the order they are to be used.

Desired productNo. of StepsWrite options
Reagent List
a.CH3CHBrCH2Brone
A.Hg(OAc)2 in H2O
b.(CH3)2CHOHtwo
B.B2H6 in THF
c.CH3CH2CH2OHtwo
C.NaBH4 in alcohol
d.CH3COCH3three
D.Br2 in CH2Cl2
e.CH3CH2CHOthree
E.H2O2 in aqueous base
f.CH3CH(OH)CH2Brone
F.HOBr(NBS in aqueous acetone)
g.(CH3)2CHBrone
G.HBr in CH2Cl2
h.CH3CH(OH)CH2OHtwo
H.OsO4 in ether
i.CH3CH2CH2Clthree
I.Thionyl chloride (SOCl2)
j.CH3CCHtwo
J.NaHSO3 in aqueous acetone
K.NaOH in alcohol and reflux
L.NaNH2 (strong base)



Among the given reaction which is faster & why?

(i) MeC|ClHMealc.KOHCH3CH=CH2

(ii) CH3CH2CH2Clalc.KOHCH3CH=CH2



Complete the reaction.
1177382_70f6876b67ca4d7ca4d11ac441e669a0.png



CH3CH2CH3cl2hν



Fill in the blanks :
HCCHBr2CCl4 _______ Zn ______.



Fill in the blank:
Acetylene and formaldehyde interact in the presence of copper acetylide as a catalyst to form the organic compound _____.



Fill in the blanks :
HCCH+CH3OCH2ClAlCl3 _______.



Why toluene reacts with bromine in presence of light gives benzyl bromide while in presence of FeBr3 it gives p-bromotoluene?



Molecules whose Lewis structures can be drawn as a ring  with alternate single and double bonds is termed as a.....



How many alkenes can be hydrogenated to give an alkane with molecular formula C4H10 which give three monochloro derivative on monochlorination.



Synthesis the following:
Propene to 2, 3-dimethyl butane



Why conjugated dienes undergo 1,4additions ? Explain.



Complete the following reactions with appropriate structure of products?
1875717_4b54a93687884608b7e233fc8c9ca95f.png



Total number of hydroxyl groups present in a molecular of the major product P is______.
1974647_47ab63bf898144cb9320a33b3f9f1955.png



Class 11 Engineering Chemistry Extra Questions