Processing math: 88%

Alcohols,Phenols And Ethers - Class 12 Engineering Chemistry - Extra Questions

How do you condemn the use of alcohol as a social practice.



Write a reasonable and detailed mechanism for the following transformation.
129132.png



Write the IUPAC name.
137508.png



Write the name and formula of the second member of the carbon compounds having functional group-OH.



Write the mechanism for the preparation of ethanol form ethane.



Name the method which can give following product
1336428_7a51fa5b59344baabe5b2374a1bf8c3d.png



Propan-1-ol cannot be prepared by acid catalysed hydration of propane, then how is propene converted into propan-1-ol?



Write the stability of given alcohols
CH3OH , CH3CH2OH, CH3CH2CH2OH



Identify missing products obtained in this reaction.
CH3CH2CH3Br2/hv(A)aqKOH(B)H2SO4Δ(C)Br2CCl4(D)



CH3C|CH3H=CH2ReagentAlcohol
Match the alcohol product with the suitable reagent.




The given IUPAC name is 1,1-dimethylcyclohexane-3-ol

Is the above statement correct?

128718_545f022b01474b78959f380ec3039331.png



The name of the compound is Cyclopent-1-en-3-ol
If true enter 1, else enter 0.

128733.png



The name of the compound is isobutyl alcohol. 
If true enter 1, else enter 0.
128706_f6c0adb77348443da16d702a0fc58106.png



Convert t-Butanol to the given compound.
243626.PNG




The given alcohol is _______ (primary/ secondary) alcohol.
(If your answer is primary type 1 else 2)
137512.png



Suggest a sequence of reactions suitable for preparing propanol from 2propanol.



 
Show how would you synthesise the above alcohols from appropriate alkenes :

249051_e09b6c996f684c5d9cf3edb4b93cd542.png



How are the following conversions carried out?
Propen  Propan-2-ol



How would you synthesize an alcohol from appropriate alkenes?



Writer the mechanism of acid dehydration of ethanol to yield ethene.



Write the equations involved in the following reaction.
Williamson ether synthesis.



Match the column I with column II.



How can you synthesize Ethanol from Ethene?



Explain why is ortho nitrophenol more acidic than ortho methoxyphenol?



Show how will you synthesise:
(i) 1-phenylethanol from a suitable alkene.
(ii) cyclohexylmethanol using an alkyl halide by an SN2 reaction.
(iii) pentan-1-ol using a suitable alkyl halide.



Write the mechanism of hydration of ethene to yield ethanol.



Write chemical reaction for the preparation of phenol from chlorobenzene.



How are the following conversions carried out?
(i) Propene Propan-2-ol
(ii) Benzyl chloride Benzyl alcohol
(iii) Ethyl magnesium chloride  Propan-1-ol
(iv) Methyl magnesium bromide  2-Methylpropan-2-ol



Show how would you synthesise the following alcohols from appropriate alkenes?
452771.PNG



Write the name and structure of an alcohol with four carbon atoms in its molecule.



How will you convert:
(i) Propene to propan1ol?  
(ii) Ethanal to propan-2-ol?



Write the IUPAC name of the given compound :
493853.PNG



Draw the structure of major monohalo product in each of the following reactions.
502182.JPG



Write the equations involved in the following reactions:
(i) Reimer - Tietmann reaction
(ii) Williamson synthesis



Arrange the following compounds in the decreasing order of their boiling points.
a) Pentan-1-ol
b) 2-Methylbutan-2-ol
c) 3-Methylbutan-2-ol



Why do alcohols have higher boiling points than haloalkanes of the same molecular mass?



Arrange the following in the decreasing order of their boiling points:
CH3CH2OH,HOCH2CH2OH,CH3CH2Cl.



Can we dry ethanol by anhydrous CaCl2?



Liquid alkalies as well as alcohols are added to water. What observation do you predict? Justify your prediction.



Ethyl alcohol and propane have nearly equal molecular weights. But, the former is a liquid with high boiling point and the latter is a gas with low boiling point. Give reason.



What is the major product when ethanol is treated with conc.H2SO4 at 413 K?



(a) Write the IUPAC name and structural formula of secondary-Butyl alcohol.
(b) Give equations for preparation of phenol from the following compounds:
(i) Benzene
(ii) Aniline.
(c) Write the resonance structures of phenol.



How is carbolic acid prepared from the following compound?
(i) Aniline
(ii) Chlorobenzene and steam at 698K?
Draw structure of DDT. Write its environmental effects.
Mention two physical properties of carbolic acid.



Write balanced chemical equations for the action of:

(1) Phosphorus trichloride on propan-2-ol
(2) Hydrogen bromide on styrene in the presence of a peroxide.
(3) Methyl bromide on silver propanoate.



Write the chemical reactions of C2H5OH with PCl3 and PCl5 separately



What is Williamson's Synthesis? Give equation.



Ethanol is heated with excess concentrated H2SO4 at 443K.
i) Name the reaction that occurs and explain it.
ii) Write the equation for the above reaction.
iii) What is the product formed? What happens when this gas is passed through bromine water?
iv) When ethanol vapour is passed through bromine water, why does no change occur?



Match the following compounds with their functional groups:
S.NoCompoundsFunctional Groups
1.Alcohol>C=O
2.AldehydeOH
3.KetoneCOOH
4.Carboxylic acidCHO



Write a balanced equation using the correct symbols for these chemical reactions:
i) Action of hydrogen on ethene in the presence of nickel catalyst.
ii) Combustion of methane evolving carbondioxide and water.
iii) Dehydrogenation of ethanol.
iv) Decarboxylation of Sodium salt of ethanoic acid.



The organic compound A of molecular formula C2H4O2 gives brisk effervescence with sodium bicarbonate solution. The sodium salt of A on treatment with soda lime gives a hydrocarbon B of molecular massIt belongs to the first member of the alkane family. What are A and B and how will you prepare A from ethanol?



How is diethyl ether prepared by continuous etherification process?



If the starting material is labeled with deuterium as indicated, how many total deuterium atoms will be present in the major elimination product of the above reactions?
706735_5684e6d6e0dd406fba3c34481e208336.jpg



A student prepared methanol in the laboratory by the addition of 266 g of CO and 60 g of H2, as shown below.
CO(g)+H2(g)CH3OH(l)
(a) Find out the limiting reagent.
(b) Calculate the amount of methanol produced and the amount of excess reactant remaining after the completion of the reaction.



Write the IUPAC name of the following.
CH3CH3|C|C2H5C|HOHCH3



How will you prepare isopropyl alcohol from propene?



IUPAC name of t-butyl alcohol ?



Find the reagents used for conversion.
869582_2aa4ee1761754ba1bc0397d6a95ad761.png



Carry out the following conversions:
(i) Phenol to benzoquinone.
(ii) Propanone to 2-Methylpropan-2-ol.
(iii) Propene to propan-2-ol.



How are the following conversions carried out ?
(i) Propene to propane-2-ol
(ii) Benzyl chloride to Benzyl alcohol
(iii) Anisole to p-Bromoanisole



Identify the products 'A' 'B' and 'C' in the following reaction
CH3CH2OHCu573K A NaCN+dil.HCl B dil.HClC?



Maximum enol content is in ?
878254_f992ac89ee5e44748c8c6a821760988e.png



Give the IUPAC name of CH3CH2CH(OH)CH3.



Write the three steps involved in the mechanism of acid catalysed dehydration of ethanol to ethene.



Give the IUPAC name of the following compound.
996398_42cfd2eda2a14840b88716353f8a4bb0.PNG



Give the IUPAC name of the following compound.
996400_49c79b4aad634095816444f521fdb876.PNG



Mark the correct order of decreasing acid strength of the following compounds.
1058510_9024f2aaf0c54fcc96eba8776b603377.PNG



Write the IUPAC name of the given compound.
1069234_655bd6ab26864ea689182d7db34a9e15.png



Predict the major product of acid catalysed dehydration:
(i) 1-methyl cyclohexanol
(ii) Butan-1-ol



Write the general formula of ether.



H2C=CHCH2OH
Classify the following as primary, secondary and tertiary alcohol.



Complete this reaction.
1078806_45f4296f00ff41218b2f09321185deac.png



Convert 1-iodopropane to propan -1-ol.



Convert Ethanal to Isopropyl alcohol.



Give the IUPAC name for the following alcohols. Classify as primary or secondary or teritiary alcohol. 
1102124_72e272ce9d44401aa999344388a2e132.png



Give the IUPAC name for the following alcohols. Classify as primary or secondary or teritiary alcohol. 
(C2H5)3COH



Give the IUPAC name for the following alcohols. Classify as primary or secondary or teritiary alcohol. 
(CH3)3CC|OHHC2H5



Give the IUPAC name for the following alcohols. Classify as primary or secondary or teritiary alcohol. 
1102117_b844c60622fc403c86fadd3b8205f656.png



Write the mechanism of hydration of ethylene to ethyl alcohol.



Give the IUPAC name for the following alcohols. Classify as primary or secondary or teritiary alcohol. 
CH2=CHCH2CH2OH



Give the IUPAC name for the following alcohols. Classify as primary or secondary or teritiary alcohol. 
1102127_671f4727b51e4e1ea2f2c87854f01371.png



Give the IUPAC name for the following alcohols. Classify as primary or secondary or teritiary alcohol. 
CH3CH|OHCH3|CHCH3



Write the iUPAC name of the following compound.
1111732_d0540da325654034833682d42dd4fa65.png



CH2OHCH2OH
Write IUPAC name of the above compound.



Write the IUPAC names of phenols given.
1129187_ec57f011235a4181a4ef3a87b2a79b85.png



Can you explain why is bimolecular dehydran not appropriate for the preparation of ethyl methyl ether?



The IUPAC name of the compound is:
H2=CHC|CH3HC|C2H5HC|OHHCH3



Arrange the following in increasing order of boiling points
1121418_a5811a2eaf794e2280dfeec464dd48e7.png



Write the product (CH3)3COHCu573K



Write the IUPAC name of the given compound.
HH|C|HH|C|OHH|C|HH|C|CH3H|C|HH



Arrange according boiling point: CH3CH2CH3,CH3CHO,CH3CH2OH,CH3OCH3.



Identify X and Y.
OH|CH3CHCH2CH3607.H2SO4,373kX+Y




What will be the product of the compound?
1174690_d842dfa61ea84eabab7e3e072d238e7c.png



Write structures of the compound of following IUPAC name :
2Methylbutan2ol



CH3COOCH2CH3+CH3MgI?



How will you convect ethanol into ethylmethyl ketone?



How is phenol (carbolic acid) prepared from Rasching's process?



What is the action of following reagent on phenol?

Bromine in CS2 at low temperature :



Give reasons :
o-nitrophenol is more volatile than p-nitrophenol



How the following conversion can be carried out?
Ethanol to propanenitrile



Toluene to benzyl alcohol



What are ethers?



Explain: Methanol is more soluble in water than Propan-1-ol.



Write the mechanism of the following reaction: 

2CH3CH2OH      H+     CH3CH2OCH2CH3 



Give reasons:
p-nitro phenol is more acidic than p-methyl phenol.



Write the name of reactant used for the preparation ethyl t-butyl ether



Write the structure of the compound whose IUPAC name is :
3 - Cyclohexylpentan - 3 - ol



Write IUPAC names of


1426029_44949373cc2a4e0eae7f2b620e5e6518.jpg



How are the following conversions carried out? (xviii) Benzene to diphenyl



How to convert methanol into ethanol? Write chemical equations only.



Write down the dehydration products of the given alcohols.
1717879_9e5c610262c84248ab489e49e8c8ac58.png



Dehydration of alcohol to form alkene is an ........ reaction. 



What happens when :
Ethyl alcohol is heated at 170C with excess of conc.H2SO4?



Complete the following equations :

CH3CH2CH=CH2CHCl3(A)NaOH(B).



Give the IUPAC names of the following compounds:
Isopropyl alcohol



The ease of dehydration of alcohols is in the order _________ > secondary > __________.



Boiling points of alcohols are ________ than those of corresponding alkanes.



Complete the above equation.
1719186_4824df5a37634f50ae33a30c91e517e0.PNG



How will you obtain ethylene from ethyl alcohol?



Write IUPAC name of the following.
1719271_39fa73efd12443a0a23292a09c56d0bd.PNG



Write the structural formula and IUPAC names of the alcoholic isomers with molecular formula C4H10O.



How will you obtain iodoform from ethyl alcohol?



Write IUPAC name of the following.

Isoamyl alcohol.



Write IUPAC name of the following.

Chloral hydrate.



Write IUPAC name of the following.
1719265_5da85f7519c643a9b4c5cc8efab57585.PNG



What happens when vapour of ethyl alcohol is passed through heated aluminium oxide at 360oC?



Write the equation for preparing ethyl alcohol in one step only from Ethylene.



The following name is inconsistent with the prevalent rules. Rename the compound in accordance with the accepted conventions:
2Phenyl3butanol.



Explain the mechanism of the following reactions:
(a) Bromine on ethylene.
(b) HBr on ethylene.



How will you obtain the following from propene?

nPropyl alcohol.



Give the mechanism of :
1720999_53a579f8c5454825ae96dc17d269ec08.PNG



Outline a synthesis of alcohol from the indicated staring material.
Allyl alcohol from propene.



Outline a synthesis of alcohol from the indicated starting material.
Isopropyl alcohol from a hydrocarbon.



Write down the name and structure of the compound obtained by dehydration of ethyl alcohol.



Complete the following equations:
2C6H5Cl+NaEther.



Fill in the blanks:
Amongst the three isomers of nitrophenol, the one that is least soluble in water is ________.



How will you prepare the following compounds from benzene?
Resorcinol.



With specific compounds write equations for the reactions involved in the following conversions:
An aromatic hydrocarbon to its hydroxy derivative.



How will you prepare the following compounds from benzene?
mNitrophenol.



mnitro ethyl benzene on Br2 and uv light,, What is the product ?



Give the major product of hydration of the above alkene.
1724959_3cadbcabf3e84e53bc58b46ca1e06ac7.PNG



Give the major product of hydration of the following alkene.
C3H6(CH3CH=CH2)H+D2O?



Identify the functional group present in the following compound and name it according to IUPAC system: CH3OH.



Give the major product of hydration of the following alkene.
C3H6(CH3CH=CH2)D+D2O?



Write the molecular formula of ethanol.



Give the major product of hydration of the following alkene.
C3H6(CH3CH=CH2)D+HOH?



Identify (F)
1767588_7aee6559bde2450e8f68e0c6d7ccf222.png



Write IUPAC name of the following compounds:

CH3CH|OHCH|OHCH3



Write IUPAC name of the following compounds:

HOCH2CH|OHCH2OH



Write IUPAC name of the following compounds:

1770096_3719bdd2b6b64093af4ed9d38a711835.png



Identify A and B in the following reactions:
1783098_0cfa38f8a20d42788018838fcfb6b0c0.jpg



How are the following conversions carried out?
Propanol to 1-propoxypropane



Write the IUPAC name of the following compound:
1781080_fec5fccbd110424396d6523ee3d79905.jpg



Write the IUPAC name of the following compound:
1781124_23ce39c7262a4d0d8689a97ef5a89180.jpg



How are the following conversions carried out?
Propanol to propan-2-ol



Give Reasons:
Relative ease of dehydration of alcohols is 3>2>1.



What is the effect of drinking methanol?



Write the main product(s) in each of the following reaction: 
1783289_1da34c9cab6041b89fbe3ba27ade0bad.png



How do you obtain the following?
Propan-2-ol  from propene



Give the trivial (common) names and the IUPAC names of the following:
CH3OH



Give the trivial (common) names and the IUPAC names of the following:
C2H5OH



What are alcohols? State their sources 



State the method of preparation of ethanol: by hydrolysis of ethene



Complete the reaction equation:
1783336_20b8891f0942410bb1591de6e696dc77.jpg



Name an organic compound which is: Called 'wood spirit



How do you convert the following:
i) Phenol to Anisole
ii) Ethanol to Propan-2-ol



What is the molecular formula of the alcohol which can be derived from propane?



Name an organic compound which is: Made from water gas 



Write structure of the compound whose IUPAC name is as follows:
3-Chloromethylpentan-l-ol



Draw the structures of all isomeric alcohols of molecular formula C5H12O and give their IUPAC names.



Identify if pentanol is insoluble, partially soluble or highly soluble in water?



Write the general formula of alcohol.



Name the reagent used in the following reaction:
Dehydration of propan-2-ol to propene.



Show how would you synthesise the above alcohol from appropriate alkene?


1829072_cfba7b584d844806b896b4b97a4f57b6.png



Write the equation of the reaction of hydrogen iodide with:

1-propoxypropane



Write the structural formulae for the following IUPAC 
propan-2ol



What happens when
chlorobenzene is subjected to hydrolysis



Write IUPAC name of the above compound:


1828894_6434abc7aee14ef8b78ac2881dcafd99.png



Explain the following with one example:

Dehydration



Write down the IUPAC name of the given compound.
1835592_e98fbb751a93470ea6a58c306729f7a2.png



Write the IUPAC name of the following organic compound:
CH3CH2CH2CH2CH2OH



Write the IUPAC name of ethyl alcohol.



Write down the IUPAC name of the compound given below:
CH3CH2CH2OH



Write down the IUPAC name of the compounds given above and and then write the name of the isomerism exhibited by it.
1835718_fd49a5b6eac9480cb988c52e88037c51.png



Can you write the IUPAC names of these two compounds?

CH2OH,CH3CH2OH



State how the following conversions can be carried out.
Ethene to Ethyl alcohol.



An optically active alcohol A (C6H10O) absorbs 2 mol of hydrogen per mole of A upon catalytic hydrogenation and gives a product B. The compound B is resistant to oxidation by CrO3 and does not show any optical activity. Deduce the structures of A and B.



Conversion of given reaction to the given product will take place in how many step?

234565.png



Match the compounds in Column I with their characteristics/tests/reactions (s) reagent(s)/stereochemistry/isomer(s) given in Column II. Matching can be one or more than one.
Column IColumn II
ReactionProduct and name of the reaction



Write the structrual formula of the major product in the following case:
Ethene mixed with air is passed under pressure over a silver catalyst at 250C.



Identify total number of 1, 2 shift during following dehydration reaction ?
295674.png



Explain the following with an example.
(i) Kolbes reaction.
(ii) Reimer-Tiemann reaction.
(iii) Williamson ether synthesis.
(iv) Unsymmetrical ether.



(i) Draw the structures of all isomeric alcohols of molecular formula C5H12O and give their IUPAC names.
(ii) Classify the isomers of alcohols in above question as primary, secondaryand tertiary alcohols.



What is meant by hydroboration-oxidation reaction? Illustrate it with an example.



When 3-methylbutan-2-ol is treated with HBr, the following reaction takes place:
Give a mechanism for this reaction.
(Hint : The secondary carbocation formed in step II rearranges to a more stable tertiary carbocation by a hydride ion shift from 3rd carbon atom.)

452775_119b59b1cf5141a9bd2da4d21bc11202.png




Write IUPAC name of the given compound:
452629_3692f0966dc64e41aac80c4c38c631b0.png



Explain the mechanism of esterification. Write the reactions involved in dehydration of 1o, 2o and 3o alcohols.



Write the correct pair of reactants for the preparation of t-butyl ethyl ether by Williamson synthesis.



Explain how Alcohols of lower molecular mass are soluble in water.



Write two methods of preparation of methyl alcohol. Describe giving diagram. Give such a test of methyl alcohol which is not given by ethyl alcohol which is not given by ethyl alcohol. Give the chemical reactions.



C6H5ClNaOHHightemperatureandpressureAHClB
Identify A and B in the above reaction.



a) Write the mechanism of acid catalysed dehydration of ethanol to ethene.
b) Between phenol and alcohol which is more acidic? Why?



Complete the following reaction
Propene H2SO4H2O,ΔA



Name the following
(1) Thte non-sublimable solid from a mxiture of  iodine and potassion nitrate.
(2) The heavier liquid component from -mercury and water
(3) The lower boiling point component from methyl alcohol and water.
(4) The compound containing one atom of sulphur and two atoms of oxygen
(5) An acid whose formula is H2CO3



Explain the following behaviours :
(i) Alcohols are more soluble in water than the hydrocarbons of comparable molecular masses.
(ii) Ortho-nitrophenol is more acidic than ortho-methoxyphenol. 
(iii) Cumene is a better starting material for the preparation of phenol. 



Write the IUPAC name of the compound in the picture.
1375959_998a9b9c870d46188c257bc3c8bf01cc.png



How will you prepare the compounds from benzene ? You may any inorganic regent and any organic reagent having not more than carbon atom
Phenylacetic acid



Discuss the mechanism of the following reactions:
(A) Dehydration of alcohols to form alkenes.



Complete the following equation.
HO||COEt+2CH3CH2MgIH2O/H+(A).



Arrange the following in decreasing order of rate of dehydration with conc. H_2SO_4:
(A) CH_3CH_2CH(OH)CH_2CH_2CH_3
(B) (CH_3)_2C(OH)CH_2CH_2CH_3
(C )(CH_3)_2C(OH)CH(CH_3)_2
(D) CH_3CH_2CH(OH)CH(CH_3)_2
(E) CH_3CH_2CH_2CH_2CH_2CH_2CH_2OH



Complete the following equation.
RCH=CH_2\overset{Hg(OAc)_2}{\underset{THF, -H_2O}{\rightarrow}}(A)\overset{NaBH_4}{\rightarrow}(B).



Complete the following equation.
1719163_53f9e8884f9f461ba04a9a89dafb270d.PNG



Answer the following.
What is the name of carbinol?



Outline a synthesis of alcohol from the indicated starting material.
1-Phenylethanol from styrene(vinyl benzene).



How will you obtain?
Ethanol from acetylene.



Show, how would you synthesize the following alcohol from appropriate alkene?
1719813_bb00002084dc4e55975865fa382d3421.PNG



Show, how would you synthesize the following alcohol from appropriate alkene?
1719818_6b9872860ba74eb4858cf54812bc33c5.PNG



Show, how would you synthesize the following alcohol from appropriate alkene?
1719816_6430291930654e76a4a9dc6eb6301070.PNG



Show, how would you synthesize the following alcohol from appropriate alkene?
1719821_c8b57d50f4224fa3bf0c1f43a48b16c4.PNG



Give reasons for the following.
Hydration of 3-phenylbut-1-ene in dil. H_2SO_4 forms 2-phenylbutan-2-ol instead of 3-phenylbutan-2-ol.



Give the major product of hydration of the following alkene.
1724949_9d448ad6aabd48f591a85e421d39eba0.PNG



Write down the dehydration product of the following.
1725020_b7f85712b6734e1d9417e4c0047fd761.PNG



Give the major product of hydration of the following alkene.
1724951_bcdfd88906f64d6bbc69afc5c5fa2cc4.PNG



Write down the dehydration product of the following.
1725021_cb3d40c91fa94200baf85b634471cfbc.PNG



Write down the dehydratiom product of the following.
1725037_209fc26b328b4009bf55a4f7cc982dc2.PNG



Convert the following:
Toluene to benzyl alcohol



Complete the above :
1767536_5e4c1b405dd64f70ab2fc15b226e1d06.png



Convert the following
1767925_dbb1a1c9d4254390baed786e3690da50.png



Identify the major and minor products.
1768486_3851dcdad3c142678fb3378ae24a76e6.png



Write the structural formula for each of the following.
Three 1^{\circ} alcohols with the formula C_{4}H_{8}O.



Why is there a large difference in th boiling points of butanal and butan-1-ol?



Which of the following is the correct method for synthesising methyl-t-butyl ether and why ?
i. (CH_{3})_{3}CBr + NaOMe\rightarrow
ii. CH_{3}Br + NaO-t-Bu\rightarrow



Give Reason for the following in one or two sentences. 
'Acid-catalysed dehydration of t-butanol is faster than that of n-butanol'.



Give reasons for the following:
Alcohols are more soluble in water than the hydrocarbons of comparable molecular masses.



Complete the following reaction.
1796967_4a3d442c8363460fa9874e995169df30.png



Complete each synthesis by giving missing starting material, reagent or products:
1780743_88c479140c314e97b773a5c1b9be1103.png



What is the order of dehydration of primary, secondary and tertiary alcohols?



How will you convert:
Propene to Propan-1-ol?



Arrange the following compounds in increasing order of acidity and give a suitable explanation. Phenol, o-nitrophenol,o-cresol.



Preperation of alcohols from alkenes involves the electrophilic attack on alkene carbon atom. Explain its mechanism.



How can propan-2-one be converted into tert-butyl alcohol?



Explain why is  O=C=O nonpolar while  R-O-R is polar.



Ethers can be prepared by Williamson's synthesis in which an alkyl halide is reacted with sodium alkoxide. Di-tert-butyl ether can't be prepared by this method. Explain.



Explain why alcohols and ethers of comparable molecular mass have different boiling points



Alcohols react with active metals e.g. Na, K etc. to give corresponding alkoxides. Write down the decreasing order of reactivity of sodium metal towards primary. secondary and tertiary alcohols.



Explain why nucleophilic reactions are not very common in phenols.



Give three methods of preparation of anisole.



Identify if phenol is insoluble, partially soluble or highly soluble in water?



Write the equation of the reaction of hydrogen iodide with:
Methoxy benzene



Alcohols are soluble in water whereas diethyl ether is not, explain with reason.



Show how you will synthesise:
1-
phenylethanol from a suitable alkene.



How would you distinguish experimentally between primary alcohol and a carboxylic acid?



The carbon-oxygen bond in phenol is slightly stronger than that in methanol. Why?



Write the equation of the reaction of hydrogen iodide with:

Benzyl ethyl ether.



How will you prepare the following from chloroform?
HC(OC_2H_5)_3  



Give the mechanism of dehydration of alcohols.



Class 12 Engineering Chemistry Extra Questions