Loading [MathJax]/jax/element/mml/optable/MathOperators.js

Aldehydes,Ketones And Carboxylic Acids - Class 12 Engineering Chemistry - Extra Questions

The IUPAC name of succinic acid is Butane-1,4-dioic acid.
If true enter 1, if false enter 0.



Write chemical equations for the following conversions:
(i) Nitrobenzene to benzoic acid.
(ii) Benzyl chloride to 2-phenylethanamine.
(iii) Aniline to benzyl alcohol.



Give the structural formulae and IUPAC names of the following compounds:
(a) Formaldehyde
(b) Acetone.



Why are aldehydes and ketones polar compounds?



Ethanol can be oxidised to ethanoic acid. Write the equation involve in the reaction.



figure 
1563054_d88a8822e995476e9f67255a2c2ef897.PNG



Draw the structure of the simplest ketone.



Write the structure of the principal organic product formed in the reaction of 1-propanol with each of the following reagents: (i) Potassium dichromate (K2Cr2O7) in adqueous sulfuric acid, heat 



What is the IUPAC name of succinic acid? 



How can the second compound be obtained from the first compound?
205899.png



 Write the product of this reaction ?
137499.png



 Write the product of this reaction :
137532.png



Bring about the following transformation:
TolueneC6H5CH2COOH



  What is the structure of E?
137083.png



CH3CHOSeO2Δ 
What is the product of this reaction:



A is an alkene. Identify the reactant A in the above reaction.
137078.png



Convert the above compound and note that KMnO4 can cause cleavage of the ring in the presence of the activating (-OH) group.
244227_6aa93ed807d4460ab7b51310cf61799f.png



    (I)                        (II)
Convert I to II.

244298_9d01e13dd508449b84ad3e62cb0130cf.png



Propose structure/structures for the hydrocarbon that gives the following products on oxidative cleavage by KMnO4/H
248310_054fff4ce7474be996541d2ca418a9f1.png



Identify E in the above reaction.
249065_d82905611a624c5cbadbb5dc088afebb.png



Complete the following.
249831_264e9d8d9db344079bb93f2cb5aebf8d.png



Identify A, B, and C.
i) Isomeric alcohols (A), (B), and (C) (C5H12O).
ii) (A) and (B) react with chromic acid solution. (B) gives an acid (D).
iii) Reactivity with HBr is: C>AB. All give the same compound, C5H11Br(E).
iv) Only (A) is oxidised by NaOI.



Identify (A) and (B) in the given sequence of reaction PhCH2CHOSeO2(A)(i)con.OH(ii)H+ (B)



Draw the structure of the following compound:
4-Chloropentan-2-one



Draw the structures of following compounds:
p-Nitropropiophenone



Draw the structure of the following compound :

p,p'-Dihydroxybenzophenone



Write structural formulae and names of four possiblealdol condensation products from propanal and butanal.III each case, indicate which aldehyde acts as nucleophile and which as electrophile.



Draw the structure of the following compound.
4-Methylpent-3-en-2-one



Complete the following reaction and write the structures of A to D.
263662_6e7102f4e9bd4e2aa362f581f5ca32b5.png



Draw structures of the following derivatives.
(i) The 2,4-dinitrophenylhydrazone of benzaldehyde
(ii) Cyclopropanone oxime
(iii) Acetaldehydedimethylacetal
(iv) The semicarbazone of cyclobutanone
(v) The ethylene ketal of hexan-3-one
(vi) The methyl hemiacetal of formaldehyde



Ethyl alcohol to trichloroacetic acid



How will you prepare the following compounds from benzene? You may use any inorganic reagent and any organic reagent having not more than one carbon atom:
(i) Methyl benzoate                 (ii) m-Nitrobenzoic acid
(iii) p-Nitrobenzoic acid           (iv) Phenylacetic acid
(v) p-Nitrobenzaldehyde.



What are ambident nucleophiles? Explain with an example



Write the main product(s) in each of the following reactions:
(i) CH3CH3|C|CH3OCH3HI
(ii) CH3CH=CH2(i)B2H6(ii)3H2O2/OH
(iii) C6H5OH(i)aq.NaOH(ii)CO2,H+



Write the IUPAC name of the compound :

   CH3CHCH2CCH3|||OHO



Name the reagents used in the following reactions:
(i) CH3COCH3?CH3|CH3CCH3|OH
(ii) CH3COOH?ClCH2COOH



Arrange the following compounds in an increasing order of their reactivity in nucleophilic addition reactions: ethanol, propanal, propanone, butanone.



Predict the products of the following reactions. 
(i) CH3C=OH2NNH2
                   |
               CH3
(ii)C6H5CH3(a)KMnO4/KOH(b)H+

(iii) PhCOOHBr2/FeBr3



Why do aldehydes and ketones have high dipole moments?



How can the following conversation be brought about:
Propanoic acid to ethylamine.



π bonds are formed by the _______ overlap of _______ orbitals.



Give the structural formulae and IUPAC names of the following compounds
(a) Malonic acid
(b) Succinic acid.



How are the following compounds prepared?
Benzaldehyde from benzoyl chloride.



How is 4-methylpent-3-en-2-one obtained from propan-e-one?



State the IUPAC names of the following compounds :
(i) CH3CH2CH2OH
(ii) HCOOH
(iii) CH3CH2CH=CH2.



Look at the picture and identify what happens. Support your answer with equations.
How is B formed from A?
622985_9ce326a0720b44aa95f902edef01df8b.png



Mention the hybridised state of carbonyl carbon atom.



How will you bring out the following conversion :
(i) Acetyl chloride to Acetaldehyde
(ii) Methanal to Ethanal.



Identify the substance underlined, in each of the following cases:
An organic compound containing - COOH functional group.



What is the IUPAC name of the compound?
854697_cc7597d4bbef49cc83d0873786d8bd23.png



What is the action of the following reagent on ethanoic acid?
LiAlH4/H3O+.



Find the number of compounds from the list below that will be oxidised by Tollens reagent (Ammonical silver nitrate solution)
H3CCHOH3COCCH3H3C|OHOCCH3H3CCH2CCHH3CCCCH3Fructose



How do you convert the following?

Toluene to Benzoic acid.



How are the following conversions carried out?
2methylbutan101 into 2methylbutanoic acid.



Find the final product of the reaction.
880034_2ca5deef4e9a43c998c64aca8d4e157d.png



Identify the organic compound : HOOC(CH2)2COOH



Ketones can also be used as one component in the :
879460_de26641227d647a7a07225b260ab3150.png



Give the IUPAC name of the given compound.
996434_a15987e0f49f4819b37fa56dcebfbe7d.PNG



Which aldehyde smell like bitter almond?  



Isopropyl alcohol convert into isobuteryic acid.



Find:


1004282_af73920af4904f3b8347e74b0fb1fc44.png



In the reaction sequence, [X] is: 
[X]KMnO4/OHHOOC(CH2)3CH3|CHCOOH.



How will you convert Benzene to Benzoic acid?



Identify A and B

1025493_fd0394c9558e4f888beaa01fb37f886c.PNG



Write any two uses of 40% solution of formaldehyde.



CH3CH2OHOCH3CHOOCH3COOH
Give the oxidizing agent in the given reactions.



Write the structure of a nitrolic acid.



Identify the organic compound A which is widely used as a preservative in pickles and has a molecular formula C2H4O2. This compound reacts with ethanol to form a sweet-smelling compound B.



How will you convert 4-nitrotoulene to 2-bromobenzoic acid?



Based on pKa values the order of decreasing acidity of carboxylic acid molecules containing EWG must be?
CF3COOH,CCl3COOH,HCCl2COOH,NO2CH2COOH,FCH2COOH,ClCH2COOH,BrCH2COOH,HCOOH,ClCH2CH2COOH,C6H5COOH,C6H5CH2COOH,CH3COOH,CH3CH2COOH.



Write the name and formula of the first member of the carbon compounds having functional group COOH.



Write the structures of aldehydes that are obtained on ozonolysis of (i) but-1-ene and (ii) but-2-ene.



Name the product obtained when alcohol is added to a carbonyl group in presence of dry HCl



Hydrocarbon A(C4H8) on reaction with HCl gives a compound B(C4H9Cl), which on reaction with 1mol of NH3 gives compound C(C4H11N). On reacting with NaNO2 and HCl followed by treatment with water. the compound C yields an optically active alcohol, D. Ozonolysis of A gives 2 mol of acetaldehyde. Identify compound D.



Which product is formed ?
1147265_014c75c76be348da9d3ddb28cf733fb3.png



Convert : Ethentrityl Ethanol



How is propanone converted into-

(i) Propan - 2 - ol
(ii) 2 - Methylpropan - 2 - ol?




Complete the reaction :
1174778_b2136e2784034f8db407130a79741899.png



What is the action of acidified potassium dichromate on acetaldehyde?



NH3 and its derivative do not show nucleophillic addition reactions with aldehydes and ketone in high acidic medium. Justify.



Write the structures of the products of the given reaction:
CH3CH2C|CH3HCHONaBH4



Image
1376040_8664da159c4f42d0ae1a2ee53d678203.PNG



Aldehydes are more reactive toward nucleophillic addition reactions than ketones. Justify.



Arrange the following compounds according to increasing order of their reactivity.
acetophenone, benzaldehyde, benzophenone



State what is formed when the compound is treated with H2SO4, heat?
1579095_58dda2deee964d7c8b8725ba208325a9.png



Conversion of acetic acid to acetone



Write structures of the products of the following reactions:
(i)CH3CH=CH2H2O/H
(iii)CH3CH2CH|CH3CHONaBH4
1560443_3308ed7efac6401582e5918fb82750cb.PNG



Classify the following compounds as acetals, ketals, hemiacetals and hemiketals.
1562626_4388d9910af048a78214dd4ec3a31cc2.jpg



State whether the following statement is True or False:
Formic acid is not the typical acid of the monocarboxylic acid series.



State whether the following statement is True or False:
The IUPAC name of acetic acid is methanoic acid.



Write the final product in the given reaction:
1719048_112acf28264d4e00ada6d19963918fa2.PNG



State whether the following statement is True or False:
Monocarboxylic acids are called fatty acids



Fill in the blanks:
Propionic acid and ethyl formate are _____ isomers.



Fill in the blanks:
Acid hydrolysis of alkyl nitriles gives ______



Complete the following equations by writing the missing (A), (B), (C), (D) etc
H2CEthyleneHBr(A)KCN(B)H2O/H+(C)



How will you synthesise?
Crotonic acid from acetaldehyde



 Answer the following:
Why the C=O in RCOOH is less reactive towards nucleophiles than in aldehydes and ketones?



How will you synthesise?
α- Hydroxy propionic acid from acetaldehyde



How will you synthesise?
Acetamide from acetone



Give the common and IUPAC names of the dicarboxylic acids, HOOC(CH2)nCOOH,n=0,1,2,3,4,5



Complete the following equations by writing the missing (A), (B), (C), (D) etc
C2H5EthylalcoholNa2Cr2O7H2SO4(A)Na2Cr2O7H2SO4(B)NaHCO3(C)sodalime(D)



Give the structural formula, common names and IUPAC names for the first six straight-chain aliphatic carboxylic acids.



Complete the following equations by writing the missing (A), (B), (C), (D) etc
CH3CHOHCN(A)H2O/H+(B)K2Cr2O7H2SO4(C)



Complete the given reactions:
1720596_8de8d6787b1c4a39be0fa2c601bbe8fe.PNG



Complete the given reactions:
1720466_16a17d805795471180ef57d746c20ff9.PNG



Fill in the blanks :
The carbonyl group in aldehydes and ketones undergoes ........... addition reactions.



Identify (A) to (F) in the given series of reaction:
1720538_2af916bd918d47acbe3d9ba6ed546c52.PNG



What are (A) and (B) in the given reaction?
1720539_1cc18cf900104ce5b3fe4ac2a967f300.PNG



Complete the given reaction:
1720607_d2db1d26277045e4be6b39e8d684b848.PNG



Give the mechansim of :
1721001_579f279028e64bb1838d255001065193.PNG



Give the mechanism of :
(i) addition of HCN to acetaldehyde



Identify the (A), (B), in the following reactions sequence:
(CH3)2C+O+C6H5NH2H+(A)H3O+Heat(B)



Identify the (A), (B), (C) and in the following reactions sequence:



1720799_667a89d4026c4d109ab13bf334934706.PNG



Give the mechansim of :
(ii) Addition of HCN to acetone



Identify the unknown compounds:

C6H5CCHNaNH2,MeI(A)Na/NH3(l)(B).



Identify the final product in the above reaction.
1721579_eaca436bcb7a4655a23e6e6a01317289.jpg



Name the final product of the following reaction:
Phenol is treated with nitric acid in the presence of H2SO4.



Complete the following equations:
C6H5CH3Air/V2O5.



How will you obtain?
Adipic acid from benzene.



Identify the unknown compounds:
1722094_ac58234b4edf49cf812eb9b2d9d35ccb.jpg



How will you prepare the following compounds from benzene?
Benzene sulphonic acid.



Give the name and structural formula of one homologue of HCOOH.



(a) When ethanoic acid reacts with sodium hydrogencarbonate, then a salt X is formed and a gas Y is evolved. Name the salt X and gas Y. Describe an activity with the help of a labeled diagram of the apparatus used to prove that the evolved gas is the one you have named. Also, write the chemical equation of the reaction involved.
(b) Give any two uses of ethanoic acid.



Write the formulae of : (a) methanoic acid; and (b) ethanoic acid.



(a) What would be observed on adding a 5% alkaline potassium permanganate solution drop by drop to some warm ethanol in a test-tube? Write the name of the compound formed during the chemical reaction. Also write chemical equation of the reaction which takes place.
(b) How would you distinguish experimentally between an alcohol and a carboxylic acid on the basis of a chemical property?



Provide the structures of compounds A, B, C, and D in the above questions.
1767850_11b86b7ce0a8437c840dd7086c056504.png



Write the IUPAC names of following ketones and aldehydes. Wherever possible, give common names also.
  • PhCH=CHCHO



Complete the above :
1767605_e7f8b46136624a5288303c4a87b507a8.png



Write the IUPAC names of following ketones and aldehydes. Wherever possible, give common names also.
  • CH3(CH2)5CHO



Write the structure of 2 hydroxybenzaldehyde.



Name the reagents used in the following reaction:

Oxidation of primary alcohol to a carboxylic acid.



Give the formula of the following functional groups
(a) Aldehyde
(b) Ketone



Do the following conversions in not more than two steps:
Propanoic acid to 2hydroxypropanoic acid



Arrange the following compounds inn increasing order of their property as indicated:
CH3COCH3,C6H5COC6H5,CH3CHO (reactivity towards nucleophilic addition reaction)



Write the IUPAC names of above ketones and aldehydes. Wherever possible, give common names also.
1767893_3faa69cb09394f5db3aa0466fc150211.png



Provide the structures of compounds A, B, C, and D in the above questions.
1767909_d0e12f60fa384ff8843a19fcc60992eb.png



Convert: Methanol to ethanoic acid



Which of the following are carboxylic acids:

C2H4O2,C2H4O,C2H6O,C3H6O2



Write the structure of the following compound : 3 oxopentanal.



Give reasons:
Propanone is less reactive than ethanal towards nucleophilic addition reactions.



Propose the mechanism for the following reaction:
CH3 CHO+ HCNH2CH3CHCN|OH



Give the IUPAC name of the following organic compounds:
1780804_c6c953f65a164250b71124e039659f84.png



Arrange the following compounds in increasing order of their reactivity in nucleopjilic addition reactions.
Benzaldehyde, pTolualdehyde, pNitrobenzaldehyde, Acetophenone.



Arrange the following compounds in increasing order of their property as indicated:
Acetaldehyde, Acetone, Methyl tert-butyl ketone ( reactivity towards HCN)



Would you expect benzalsehyde to be more reactive or less reactive in nucleophilic addition reaction than propanal? Explain your answer.



Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions.
Ethanal, Propanal, Propanone, Butanone



Give the IUPAC name of the following organic compounds:


1780806_62d9bb9a91f54495b09b5be58e8d5d3e.png



Write the structural formula and IUPAC name of the compound: di-sec.
butylketone.



Write the IUPAC name of the following:
1807046_eca545e71a3e416eb1707abbca423116.png



The monoamino monocarboxylic acids have two pKa values. Explain.



How would you bring about the conversion of Propanol to propanoic acid? Name the process and write reaction involved.




Draw the structure of the following derivatives:
The 2,4-Dinitrophenylhydrazone of benzaldehyde



Draw the structure of the following derivatives:
Cyclopanone oxime



Suggest a reagent for the conversion of ethanol to ethanoic acid.



What are carboxylic acids? Give their formula



Draw the structure of the following derivatives:
Acetaldehyde dimethyl acetal 



write the name and structure of an aldehyde with four carbon atoms in its molecule.



Given the IUPAC names of the following compounds numbered (i) to (v). The IUPAC name of thr compounds on the left are to guide you for given the correct IUPAC names of the compounds on the right.
1807547_86e9723a187f4654a7990ec59c1cd799.png



Identify the odd one out and justify.
Acetic acid, carbonic acid, hydrochloric acid, nitric acid 



Give the structural formulae and IUPAC name of acetic acid. What is glacial acetic acid?



Write the IUPAC name of the following structural formulae.
CH3CH3COOH 



Write structural formulae for the following IUPAC name.
butanone



Write the common name, IUPAC name and formula of one monocarboxylic acid and one dicarboxylic acid



Write the structural formulae for the following IUPAC 
butanoic acid



Write the structural formulae for the following IUPAC name .pent-2-one



Show how each of the following compounds can be converted to benzoic acid,
Ethylbenzene



Give the IUPAC names of the following compounds:
1829416_3e994a4d07d34d8097dc0d4a6418954c.jpg



What product is obtained when ethyl benzene is oxidized with alkaline KMnO4



Show how each of the following compounds can be converted to benzoic acid,
Bromobenzene



Give the IUPAC names of the following compounds:
1829417_84dcabe7420f4161b89b4614d2470d97.jpg



Show how each of the following compounds can be converted to benzoic acid,
Phenylethene (Styrene)



Give the names of the functional group
> C = O



Draw structures of the following derivatives.
Acetaldehydedimethylacetal



Complete each synthesis by giving missing starting material, reagent or products
1829163_7e181b32004c4fcdbb879206b82f3e13.jpg



Write the IUPAC names of the following ketones and aldehydes. Wherever possible, give also common names.
CH3CH2CHBrCH2CH(CH3)CHO



Write down the IUPAC name of the given compound.
CH3CH2CH2COOH



Write the structural formula of the following compounds. 
3-Bromo-4-phenyl pentanoic acid



Write the uses of methanoic acid.



Write the structural formula and IUPAC name of the following compounds:
(i) Formic acid
(ii) Ethyl acetate
(iii) Ethyl methyl ether



Write the IUPAC name of OHCCH2CH2COOH



Write the IUPAC name of glycerol and crotonic acid.



Write the IUPAC names of 
1829473_cdeb6fb938634a8bb775e99e29268a49.jpg



Write the structural formula of the following compounds. 
Hex -2-en-4- ynoic acid



Draw the structure of 4 methyl pent -3 ene-2one.



Write down the IUPAC name of the compound given below:
CH3CH2CH2CH2CH2COOH



List out the uses of ethanoic acid.



Write the IUPAC name of the following organic compound:
CH3COOH



3 mL, of ethanol is taken in a test tube and warmed gently in a water bath. A 5% solution of alkaline potassium permanganate is added first drop by drop to this solution, then in excess.
Write chemical equation of this reaction.



Give hybridization state of each carbon in the following compounds:
(CH3)2CO



Column I
( organic compounds oxidised by HIO4 )
Column II
( products of 
HIO4 oxidation )



Consider the reaction in column-I and match them with product properties in column-II



An organic compound has molecular formula A (C7H10) and known to decolourized Br2-water solution.A on reduction with H2/Pt produces B (C7H14). B on monochlorination with Cl2/hv produces four isomeric monochloro derivatives C7H13Cl. A on ozonolysis followed by work-up with Zn-dimethyl sulphide affords two and only two products, one being methanal and other C (C6H8O3). C is oxidised with acidic solution of dochromate to yields D (C6H8O5) which is soluble in NaHCO3. D is reduced with NaBH4 to yield E (C6H10O3) which may be resolved into enantiomers. Identify A to E.



Identify (A) To (C)
247665_06933cc2e5604b8db16ff4336bb4bc37.png



Identify the products.
248215_4dc501c456dc4cf7babfa3909776b21e.png



Match the Compounds given in List-I with their Uses in List-II.



The compound which would undergo nucleophilic substitution fastest would be
CH3CH2CONH2
CH3CH2COOCH3
CH3CH2COCl
304711.png



How many equivalents of HCHO are formed by oxidative cleavage of one equivalent of D-glucose by excess of HIO4 in water?



Draw the structures of the following compounds.
(i) 3-Methylbutanal                             (ii) p-Nitropropiophenone
(iii) p-Methylbenzaldehyde                 (iv) 4-Methylpent-3-en-2-one
(v) 4-Chloropentan-2-one                  (vi) 3-Bromo-4-phenylpentanoic acid
(vii) p,p-Dihydroxybenzophenone     (viii) Hex-2-en-4-ynoic acid



How will you convert:
(i) Ethanoic acid into methanamine
(ii) Hexanenitrile into 1-aminopentane
(iii) Methanol to ethanoic acid
(iv) Ethanamine into methanamine
(v) Ethanoic acid into propanoic acid
(vi) Methanamine into ethanamine
(vii) Nitromethane into dimethylamine
(viii) Propanoic acid into ethanoic acid?



An organic compound with molecular formula C9H10O forms 2, 4-DNP derivative, reduces Tollen's reagent and undergoes Cannizaro reaction. On vigorous oxidation it gives a dicarboxylic acid which is used in the preparation of terylene. Identify the organic compound.



Aldehydes, ketones and acids contain CO group.
(a) Name the product obtained by the reaction between Acetic acid and Ethanol.
(b) Give any two tests to distinguish between aldehydes and ketones.



Give one chemical test each to distinguish between the following pairs of compounds:
(1) Ethanol and acetic acid
(2) Acetaldehyde and benzaldehyde



Prepare carbolic acid from benzene sulphonic acid. Write a chemical equation for the action of neutral ferric chloride on phenol.



Find A, B, C, D, and E in the given table.
992026_16bd7c134b8841b99096e20996a58e21.PNG



Name the product obtained when alcohol is added to the carbonyl group in the presence of dry HCl?



LiAlH4A..............................
1222802_5fa52db7321a401a8dd619d59973adff.PNG



How many -COOH the product has? 
1178121_780e3a7059e749739081e2f3a1e75992.png



There are seven isomeric compounds with the formula C4H10O. Write their structure and identify their functional groups.



Write the structures of the following compounds.
4-Fluoroacetophenone



What is the functional groups in the following molecules?
CH3COOH



Arrange the following in the increasing order of their reactivity towards nucleophilic addition reaction :
1700710_3af09c69dc934bfeb85e5130f7e50d91.png



Answer the following questions:

Explain the mechanism of aldol addition reaction.
Mention two uses of carboxylic acids.



Match the following:
(A) Acetic acid(1) Soda lime(M) ClCH2COOH
(B) Formic acid(2) Poisonous(N) Dicarboxylic acid
(C) Decaboxylation(3) Phosphorus(O) Soap
(D) Hell-Volhard-Zelinsky reaction(4) Kolbe's synthesis(P) Fermentation of sugar
(E) Oxalic acid(5) Saponification(Q) Carbon monoxide
(F) Electrolysis of CH3COOK(6) Vinegar(R) Alkane
(G) CH3COOC2H5+NaOH(7) Dehydration(S) Reducing acid
(H) Formic acid +conc. H2SO4(8) Red ants(T) Ethane



Write the products formed when benzaldehyde reacts with the following reagents :
(i) CH3CHO in presence of dilute NaOH
(ii) NH2NHC6H5
(iii) Conc. NaOH



Two isomeric compounds (A) and (B) have molecular formula C6H10. Oxidation of (A) gives mixture of butanoic and acetic acids, whereas compound (B) gives hexa-1,6-dioic acid. What are (A) and (B)?



Complete the given reactions:
1720534_6001fe2008b840f4a5203b81a030f756.PNG



Show the steps to carry out the following transformation:

Ethylbenzene 2-phenyl propionic acid



Fill in the blanks :
Trimer of acetaldehyde has a structure ........... . 



Complete the given reactions:
1720473_7468437c352d4a619887158815c7a7ec.PNG



A ketone (A) which undergoes haloform reaction gives compound (B) on reduction. (B) on heating with H2SO4 gives compound (C), which forms monozonide (D). (D) on hydrolysis in the presence of Zn dust gives only acetaldehyde. Identify(A), (B) and (C).



Amongst o-hydroxybezaldehyde and p-hydroxy-benzaldehyde which is more soluble in water?



Write the intermediate steps for the following reaction:
C6H5CH(OH)CCHH3O+C6H5CH=CHCHO.



Match the following
1751922_5b9ed7cef84e4b48a61de5b6f30aa039.PNG



complete the reaction
1767527_e3af4008412743f49b869962505346fa.png



Complete the above:
1767535_701aa89a43d24b589174b7eb5abd5e42.png



Convert
1767525_db9099b257c046dd8674d4f53f077bfa.png



Name and complete the above reaction.
1767526_3a21d9b331574361a1491b17c824df53.png



Convert CH3CHO into CH3CH(OH)COOH
1767562_f48f6d913a7d43fa885d06aaab51c2dd.png



Complete the above :
1767598_ed4237d72fba4b4585f9a2f9d237dada.png



Complete the above :
1767595_53ef3f3288b94f2ca7e2d7ec2af4736e.png



Give the structure of products (A) & (B).
1767684_85c10cb63b2541ed9f59ca83671ffdc1.png



An organic compound (A)(C5H7OCl) reacts rapidly with ethanol to give (B)(C7H12O2).(A) also reacts with water to produce an acid which reacts with bromine to give (C)(C5H8Br2O2).(B) on boiling with H2SO4 forms an acid (D). When (D) is oxidised with KMnO4, an acid (E)(C4H6O3) is produced. On mild heating , (E) gives (F)(C3H6O) which cannotb be oxidised by ammoniacal AgNO3. Identify the compounds (A) to (F).



Complete the following reaction::

2PhCHO+NH2NH2



Complete the above :
1767603_068ddafc92a94de08beb9ce086baf5a6.png



Complete the above:
1767754_b15b785976ea4af7a8bd832c16d1d01c.png



Convert the following:
Ethyl bromide to propanoic acid



How will you bring about the following conversions in not more than two steps ?
Benzaldehyde to αHydroxyphenylacetic acid



Complete each synthesis by giving the missing starting material, reagent, or products.


1768010_a98383f08e2b46d1a9f3b05e374860d1.png



Provide the structures of compounds A, B, C, and D in the above questions.
1767851_3f6515c707e44bbc84865588ed5eb365.png



What would be the major product in the above reaction ?
1770080_018df549ca834fb9a862dda9bdfc358d.png



Complete the above reactions with appropriate structures of products / reagents.
1770060_95fb7e5398234608909194a4c3c4b388.png




Write the products (s) in the following reactions:
(i) & (ii) - Refer Image
(iii) CH_2 = CH - CH_2 - CN \xrightarrow[(b) H_2O]{(a) DIBAL-H}

1780602_59c52177f56d42c5a08582ac390f856e.png



Write chemical reaction to affect the following transformations:
Benzyl alcohol to phenylethanoic acid



Write chemical reaction to affect the following transformations:
Butan -1-ol to butanoic acid



Answer the following questions
Give reasons for the following:
Ethanal is more reactive than acetone towards nucleophilic addition reaction.



Complete the above, giving the structures of principal organic products.
1770055_ffffadeb259645ed9eacce54bf1f8d7b.png



pK_3 of chloroacetic acid is lower than pK_3 of acetic acid. Explain.



A compound 'X'(C_2H_4O) on oxidation gives 'Y'(C_2H_4O_2). 'X' undergoes haloform reaction. On treatment with HCN\ 'X' forms a product 'Z which on hydrolysis gives 2- hydroxy propanoic acid.
Write down structures of 'X' and 'Y'.



Alkenes (> C = C <) and carbonyl compounds (> C = 0), both contain a \pi bond but alkenes show electrophilic reactions whereas carbonyl compounds show nucleophilic addition reactions. Explain.



Predict the products formed when cyclohexanecarbaldehyde reacts with following reagents.
Tollens' reagent?



An organic compound A on treatment with ethyl alcohol gives carboxylic acid B and compound C. Hydrolysis of C under acidic conditions given B and D. Oxidation of D with KMnO_{4} also gives B, B on heating with Ca(OH)_{2} gives E with molecular formula C_{3}H_{6}O. E does not give Tollen test or reduce Fehling solution but forms 2, 4- dinitrophenyl hydrazone. Identify A, B, C, D, E.



Answer the following questions
How would you account for the following:
Aldehydes are more reactive than ketones towards nucleophilies.



Answer the following questions
How would you account for the following:
The aldehydes and ketones undergo a number of addition reactions.



Answer the following questions
A ketone A which undergoes haloform reaction gives compound B on reduction. B on heating with sulphuric acid gives compound C, which forms mono-ozonide D. The compound D on hydrolysis in presence of zinc dust gives only acetaldehyde . Write the structures and IUPAC names of A, B and C Write down the reactions involved.



Write chemical reaction to affect the following transformations:
Cyclohexene to hexane -1, 6- dioic acid



An aldehyde as well as a ketone can be represented by the same molecular formula, say  C_{3}H_{6}O . Write their structures and name them. State the relation between the two in the language of science



How will you bring about the following conversions in not more than two steps?
Benzaldehyde to a -Hydroxyphenylacetic acid



Predict the product of the following reactions:
1829414_5a2ff051b94d43a7ac72779211135b6c.jpg



Complete each synthesis by giving missing starting material, reagent, or products.
1829401_bdfbb0b0dfcd4838a702a2cbf4402db3.jpg



Carboxylic acids contain carbonyl group but do not show the nucleophilic addition reaction like aldehydes or ketones. Why?



Draw structural formula for each of the following compounds:
ethanal
What is used to describe these compounds taken together?



How will you covert:
Methonal to ethanoic acid



Write the following decreasing order of nucleophilic addition.
CH_3CHO , CH_3COCH_3 , HCHO , C_2H_5 COCH_3  



How can ethanol be converted into ethanoic acid?



Draw the structural formula for each of the following compounds: "acetone"



Explain the following reactions and give equations also :
Addition product obtained by addition of alcohol to aldehydes and ketones



Molecular formula of some compounds are given in the box.
C_{2}H_{4}  , C_{6}H_{14}, CH_{3}-CH_{2}-Cl , CH_{3}-COOH C_{6}H_{6}

Which compound can be used in food?



Arrange the following in decreasing ease of acid-catalysed esterification:
1966835_f44be6b819634d65960d560838c8d70f.png



Class 12 Engineering Chemistry Extra Questions